C16H21N3O2 — CID 20785690
tert-butyl 4-(3-isocyanophenyl)piperazine-1-carboxylate (PubChem CID 20785690) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl 4-(3-isocyanophenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-isocyanophenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 20785690 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | tert-butyl 4-(3-isocyanophenyl)piperazine-1-carboxylate |
| SMILES | [C-]#[N+]c1cccc(N2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C16H21N3O2/c1-16(2,3)21-15(20)19-10-8-18(9-11-19)14-7-5-6-13(12-14)17-4/h5-7,12H,8-11H2,1-3H3 |
| InChIKey | XEEMXAOUXKLKPL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|