C16H25N5O2 — CID 163422104
tert-butyl 4-[3-(diaminomethylideneamino)phenyl]piperazine-1-carboxylate (PubChem CID 163422104) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is tert-butyl 4-[3-(diaminomethylideneamino)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(diaminomethylideneamino)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 163422104 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | tert-butyl 4-[3-(diaminomethylideneamino)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cccc(N=C(N)N)c2)CC1 |
| InChI | InChI=1S/C16H25N5O2/c1-16(2,3)23-15(22)21-9-7-20(8-10-21)13-6-4-5-12(11-13)19-14(17)18/h4-6,11H,7-10H2,1-3H3,(H4,17,18,19) |
| InChIKey | AJIAIYYVVVCGDR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|