C18H28N6O3 — CID 163582357
tert-butyl N-[2-[4-[3-(diaminomethylideneamino)phenyl]piperazin-1-yl]-2-oxoethyl]carbamate (PubChem CID 163582357) has the molecular formula C18H28N6O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[3-(diaminomethylideneamino)phenyl]piperazin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[3-(diaminomethylideneamino)phenyl]piperazin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 163582357 |
| Molecular Formula | C18H28N6O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | tert-butyl N-[2-[4-[3-(diaminomethylideneamino)phenyl]piperazin-1-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCN(c2cccc(N=C(N)N)c2)CC1 |
| InChI | InChI=1S/C18H28N6O3/c1-18(2,3)27-17(26)21-12-15(25)24-9-7-23(8-10-24)14-6-4-5-13(11-14)22-16(19)20/h4-6,11H,7-10,12H2,1-3H3,(H,21,26)(H4,19,20,22) |
| InChIKey | GIPOOWWFLUYHLN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|