C17H25N3O2 — CID 146454443
tert-butyl 4-(2,3-dihydro-1H-isoindol-5-yl)piperazine-1-carboxylate (PubChem CID 146454443) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is tert-butyl 4-(2,3-dihydro-1H-isoindol-5-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,3-dihydro-1H-isoindol-5-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 146454443 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | tert-butyl 4-(2,3-dihydro-1H-isoindol-5-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc3c(c2)CNC3)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-17(2,3)22-16(21)20-8-6-19(7-9-20)15-5-4-13-11-18-12-14(13)10-15/h4-5,10,18H,6-9,11-12H2,1-3H3 |
| InChIKey | CLOJUQREQJNDQT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|