C28H35N3O3 — CID 169302275
tert-butyl 4-(10-oxo-7-piperidin-1-yl-9H-anthracen-2-yl)piperazine-1-carboxylate (PubChem CID 169302275) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is tert-butyl 4-(10-oxo-7-piperidin-1-yl-9H-anthracen-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(10-oxo-7-piperidin-1-yl-9H-anthracen-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 169302275 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | tert-butyl 4-(10-oxo-7-piperidin-1-yl-9H-anthracen-2-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc3c(c2)Cc2cc(N4CCCCC4)ccc2C3=O)CC1 |
| InChI | InChI=1S/C28H35N3O3/c1-28(2,3)34-27(33)31-15-13-30(14-16-31)23-8-10-25-21(19-23)17-20-18-22(7-9-24(20)26(25)32)29-11-5-4-6-12-29/h7-10,18-19H,4-6,11-17H2,1-3H3 |
| InChIKey | OXPKCFPBHQMCCW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |