C17H24N3O5- — CID 143958593
5-[4-[(2-methylpropan-2-yl)oxycarbonyl]-1,4-diazepan-1-yl]-2-(oxidoamino)benzoic acid (PubChem CID 143958593) has the molecular formula C17H24N3O5- and a molecular weight of 350.40 g/mol. Its IUPAC name is 5-[4-[(2-methylpropan-2-yl)oxycarbonyl]-1,4-diazepan-1-yl]-2-(oxidoamino)benzoic acid.
| Compound Name | 5-[4-[(2-methylpropan-2-yl)oxycarbonyl]-1,4-diazepan-1-yl]-2-(oxidoamino)benzoic acid |
|---|---|
| PubChem CID | 143958593 |
| Molecular Formula | C17H24N3O5- |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 5-[4-[(2-methylpropan-2-yl)oxycarbonyl]-1,4-diazepan-1-yl]-2-(oxidoamino)benzoic acid |
| SMILES | CC(C)(C)OC(=O)N1CCCN(c2ccc(N[O-])c(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C17H24N3O5/c1-17(2,3)25-16(23)20-8-4-7-19(9-10-20)12-5-6-14(18-24)13(11-12)15(21)22/h5-6,11,18H,4,7-10H2,1-3H3,(H,21,22)/q-1 |
| InChIKey | KLTPLIWMVSCXBA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|