C16H23N3O4 — CID 168992585
tert-butyl 4-(4-formamido-3-hydroxyphenyl)piperazine-1-carboxylate (PubChem CID 168992585) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is tert-butyl 4-(4-formamido-3-hydroxyphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-formamido-3-hydroxyphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168992585 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | tert-butyl 4-(4-formamido-3-hydroxyphenyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(NC=O)c(O)c2)CC1 |
| InChI | InChI=1S/C16H23N3O4/c1-16(2,3)23-15(22)19-8-6-18(7-9-19)12-4-5-13(17-11-20)14(21)10-12/h4-5,10-11,21H,6-9H2,1-3H3,(H,17,20) |
| InChIKey | BWLMFYXAQANYRG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|