C18H26N2O2 — CID 144819263
tert-butyl 4-(4-ethenyl-3-methylphenyl)piperazine-1-carboxylate (PubChem CID 144819263) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is tert-butyl 4-(4-ethenyl-3-methylphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-ethenyl-3-methylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 144819263 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | tert-butyl 4-(4-ethenyl-3-methylphenyl)piperazine-1-carboxylate |
| SMILES | C=Cc1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1C |
| InChI | InChI=1S/C18H26N2O2/c1-6-15-7-8-16(13-14(15)2)19-9-11-20(12-10-19)17(21)22-18(3,4)5/h6-8,13H,1,9-12H2,2-5H3 |
| InChIKey | XYFKOWHWXUDMDB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|