C18H29ClN2O2 — CID 143766632
tert-butyl 4-(4-chloro-3-methylphenyl)piperazine-1-carboxylate;ethane (PubChem CID 143766632) has the molecular formula C18H29ClN2O2 and a molecular weight of 340.90 g/mol. Its IUPAC name is tert-butyl 4-(4-chloro-3-methylphenyl)piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-(4-chloro-3-methylphenyl)piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143766632 |
| Molecular Formula | C18H29ClN2O2 |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | tert-butyl 4-(4-chloro-3-methylphenyl)piperazine-1-carboxylate;ethane |
| SMILES | CC.Cc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)ccc1Cl |
| InChI | InChI=1S/C16H23ClN2O2.C2H6/c1-12-11-13(5-6-14(12)17)18-7-9-19(10-8-18)15(20)21-16(2,3)4;1-2/h5-6,11H,7-10H2,1-4H3;1-2H3 |
| InChIKey | RFVWYSHAZAHEFQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |