C17H24ClNO3 — CID 123559362
tert-butyl 4-(4-chloro-3-methylphenyl)-4-hydroxypiperidine-1-carboxylate (PubChem CID 123559362) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is tert-butyl 4-(4-chloro-3-methylphenyl)-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-chloro-3-methylphenyl)-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 123559362 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | tert-butyl 4-(4-chloro-3-methylphenyl)-4-hydroxypiperidine-1-carboxylate |
| SMILES | Cc1cc(C2(O)CCN(C(=O)OC(C)(C)C)CC2)ccc1Cl |
| InChI | InChI=1S/C17H24ClNO3/c1-12-11-13(5-6-14(12)18)17(21)7-9-19(10-8-17)15(20)22-16(2,3)4/h5-6,11,21H,7-10H2,1-4H3 |
| InChIKey | AZSCHDOSQIYGHI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |