C17H24BrNO3 — CID 18379530
tert-butyl 4-(4-bromo-2-methylphenyl)-4-hydroxypiperidine-1-carboxylate (PubChem CID 18379530) has the molecular formula C17H24BrNO3 and a molecular weight of 370.29 g/mol. Its IUPAC name is tert-butyl 4-(4-bromo-2-methylphenyl)-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-bromo-2-methylphenyl)-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 18379530 |
| Molecular Formula | C17H24BrNO3 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | tert-butyl 4-(4-bromo-2-methylphenyl)-4-hydroxypiperidine-1-carboxylate |
| SMILES | Cc1cc(Br)ccc1C1(O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H24BrNO3/c1-12-11-13(18)5-6-14(12)17(21)7-9-19(10-8-17)15(20)22-16(2,3)4/h5-6,11,21H,7-10H2,1-4H3 |
| InChIKey | GQLRKACYRGLTJJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |