C18H23NO3S — CID 71512889
tert-butyl 4-(1-benzothiophen-3-yl)-4-hydroxypiperidine-1-carboxylate (PubChem CID 71512889) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is tert-butyl 4-(1-benzothiophen-3-yl)-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(1-benzothiophen-3-yl)-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 71512889 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | tert-butyl 4-(1-benzothiophen-3-yl)-4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(c2csc3ccccc23)CC1 |
| InChI | InChI=1S/C18H23NO3S/c1-17(2,3)22-16(20)19-10-8-18(21,9-11-19)14-12-23-15-7-5-4-6-13(14)15/h4-7,12,21H,8-11H2,1-3H3 |
| InChIKey | QKIPLDLNQGWDNB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |