C15H20ClNO3 — CID 170985255
tert-butyl 3-(2-chlorophenyl)-3-hydroxypyrrolidine-1-carboxylate (PubChem CID 170985255) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is tert-butyl 3-(2-chlorophenyl)-3-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-chlorophenyl)-3-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170985255 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | tert-butyl 3-(2-chlorophenyl)-3-hydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(c2ccccc2Cl)C1 |
| InChI | InChI=1S/C15H20ClNO3/c1-14(2,3)20-13(18)17-9-8-15(19,10-17)11-6-4-5-7-12(11)16/h4-7,19H,8-10H2,1-3H3 |
| InChIKey | WQTODWXJUXVCKG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |