C17H25NO4 — CID 139491021
tert-butyl 3-hydroxy-3-(2-methoxyphenyl)piperidine-1-carboxylate (PubChem CID 139491021) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-(2-methoxyphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-(2-methoxyphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139491021 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | tert-butyl 3-hydroxy-3-(2-methoxyphenyl)piperidine-1-carboxylate |
| SMILES | COc1ccccc1C1(O)CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H25NO4/c1-16(2,3)22-15(19)18-11-7-10-17(20,12-18)13-8-5-6-9-14(13)21-4/h5-6,8-9,20H,7,10-12H2,1-4H3 |
| InChIKey | GMKVUIGCXNMUAI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |