C17H25NO3 — CID 97114215
tert-butyl (3R)-3-benzyl-3-hydroxypiperidine-1-carboxylate (PubChem CID 97114215) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is tert-butyl (3R)-3-benzyl-3-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-benzyl-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 97114215 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | tert-butyl (3R)-3-benzyl-3-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@](O)(Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H25NO3/c1-16(2,3)21-15(19)18-11-7-10-17(20,13-18)12-14-8-5-4-6-9-14/h4-6,8-9,20H,7,10-13H2,1-3H3/t17-/m1/s1 |
| InChIKey | INDMQUKKKYXEIW-QGZVFWFLSA-N |
| XLogP | 2.99 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |