C11H21NO4 — CID 97172659
tert-butyl (3S)-3-hydroxy-3-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 97172659) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is tert-butyl (3S)-3-hydroxy-3-(hydroxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-hydroxy-3-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97172659 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | tert-butyl (3S)-3-hydroxy-3-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@](O)(CO)C1 |
| InChI | InChI=1S/C11H21NO4/c1-10(2,3)16-9(14)12-6-4-5-11(15,7-12)8-13/h13,15H,4-8H2,1-3H3/t11-/m0/s1 |
| InChIKey | BZUJNOSCUZJLSA-NSHDSACASA-N |
| XLogP | 0.74 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |