About tert-butyl 1-methyl-1,9-diazaspiro[4.5]decane-9-carboxylate
tert-butyl 1-methyl-1,9-diazaspiro[4.5]decane-9-carboxylate (PubChem CID 90236843) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is tert-butyl 1-methyl-1,9-diazaspiro[4.5]decane-9-carboxylate.
Analyze tert-butyl 1-methyl-1,9-diazaspiro[4.5]decane-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1-methyl-1,9-diazaspiro[4.5]decane-9-carboxylate?
The IUPAC name of tert-butyl 1-methyl-1,9-diazaspiro[4.5]decane-9-carboxylate (CID 90236843) is tert-butyl 1-methyl-1,9-diazaspiro[4.5]decane-9-carboxylate.
What is the SMILES notation for tert-butyl 1-methyl-1,9-diazaspiro[4.5]decane-9-carboxylate?
The canonical SMILES for tert-butyl 1-methyl-1,9-diazaspiro[4.5]decane-9-carboxylate is CN1CCCC12CCCN(C(=O)OC(C)(C)C)C2.
What is the InChIKey of tert-butyl 1-methyl-1,9-diazaspiro[4.5]decane-9-carboxylate?
The InChIKey is GHQBCFZQHMZPED-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2/c1-13(2,3)18-12(17)16-10-6-8-14(11-16)7-5-9-15(14)4/h5-11H2,1-4H3.
What are the key properties of tert-butyl 1-methyl-1,9-diazaspiro[4.5]decane-9-carboxylate?
tert-butyl 1-methyl-1,9-diazaspiro[4.5]decane-9-carboxylate has a molecular weight of 254.37 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1-methyl-1,9-diazaspiro[4.5]decane-9-carboxylate is sourced from PubChem (CID 90236843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).