About tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane
tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane (PubChem CID 155737634) has the molecular formula C13H28N2O2
and a molecular weight of 244.38 g/mol. Its IUPAC name is tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane.
Molecular Properties
| Compound Name | tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane |
| PubChem CID | 155737634 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCC[C@](C)(N)C1 |
| InChI | InChI=1S/C11H22N2O2.C2H6/c1-10(2,3)15-9(14)13-7-5-6-11(4,12)8-13;1-2/h5-8,12H2,1-4H3;1-2H3/t11-;/m0./s1 |
| InChIKey | SZYKBBXOMOQGTH-MERQFXBCSA-N |
| XLogP | 2.76 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane?
The IUPAC name of tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane (CID 155737634) is tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane.
What is the SMILES notation for tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane?
The canonical SMILES for tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane is CC.CC(C)(C)OC(=O)N1CCC[C@](C)(N)C1.
What is the InChIKey of tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane?
The InChIKey is SZYKBBXOMOQGTH-MERQFXBCSA-N. The full InChI is InChI=1S/C11H22N2O2.C2H6/c1-10(2,3)15-9(14)13-7-5-6-11(4,12)8-13;1-2/h5-8,12H2,1-4H3;1-2H3/t11-;/m0./s1.
What are the key properties of tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane?
tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane has a molecular weight of 244.38 g/mol, XLogP of 2.76, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S)-3-amino-3-methylpiperidine-1-carboxylate;ethane is sourced from PubChem (CID 155737634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).