C11H20NO2Zn+ — CID 162464292
zinc tert-butyl 3-methanidyl-3-methylpyrrolidine-1-carboxylate (PubChem CID 162464292) has the molecular formula C11H20NO2Zn+ and a molecular weight of 263.68 g/mol. Its IUPAC name is zinc tert-butyl 3-methanidyl-3-methylpyrrolidine-1-carboxylate.
| Compound Name | zinc tert-butyl 3-methanidyl-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162464292 |
| Molecular Formula | C11H20NO2Zn+ |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | zinc tert-butyl 3-methanidyl-3-methylpyrrolidine-1-carboxylate |
| SMILES | [CH2-]C1(C)CCN(C(=O)OC(C)(C)C)C1.[Zn+2] |
| InChI | InChI=1S/C11H20NO2.Zn/c1-10(2,3)14-9(13)12-7-6-11(4,5)8-12;/h4,6-8H2,1-3,5H3;/q-1;+2 |
| InChIKey | FULVCHPYTYPBHN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|