C12H25NO5 — CID 156848744
tert-butyl 3,3-dimethoxypyrrolidine-1-carboxylate;methanol (PubChem CID 156848744) has the molecular formula C12H25NO5 and a molecular weight of 263.33 g/mol. Its IUPAC name is tert-butyl 3,3-dimethoxypyrrolidine-1-carboxylate;methanol.
| Compound Name | tert-butyl 3,3-dimethoxypyrrolidine-1-carboxylate;methanol |
|---|---|
| PubChem CID | 156848744 |
| Molecular Formula | C12H25NO5 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | tert-butyl 3,3-dimethoxypyrrolidine-1-carboxylate;methanol |
| SMILES | CO.COC1(OC)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H21NO4.CH4O/c1-10(2,3)16-9(13)12-7-6-11(8-12,14-4)15-5;1-2/h6-8H2,1-5H3;2H,1H3 |
| InChIKey | FZHBNIWOULJKPS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|