C10H19NO4 — CID 71630502
tert-butyl 3-hydroxy-3-(hydroxymethyl)pyrrolidine-1-carboxylate (PubChem CID 71630502) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-(hydroxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-(hydroxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71630502 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | tert-butyl 3-hydroxy-3-(hydroxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(CO)C1 |
| InChI | InChI=1S/C10H19NO4/c1-9(2,3)15-8(13)11-5-4-10(14,6-11)7-12/h12,14H,4-7H2,1-3H3 |
| InChIKey | RMEKXQFQLXPULQ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |