C10H20N2O4 — CID 105490874
tert-butyl 3-(aminooxymethyl)-3-hydroxypyrrolidine-1-carboxylate (PubChem CID 105490874) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is tert-butyl 3-(aminooxymethyl)-3-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(aminooxymethyl)-3-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 105490874 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | tert-butyl 3-(aminooxymethyl)-3-hydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(CON)C1 |
| InChI | InChI=1S/C10H20N2O4/c1-9(2,3)16-8(13)12-5-4-10(14,6-12)7-15-11/h14H,4-7,11H2,1-3H3 |
| InChIKey | YVXFCJJCEPXRAL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|