C11H20N2O4 — CID 142979907
tert-butyl 4-hydroxy-4-(nitrosomethyl)piperidine-1-carboxylate (PubChem CID 142979907) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-(nitrosomethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-(nitrosomethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142979907 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | tert-butyl 4-hydroxy-4-(nitrosomethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(CN=O)CC1 |
| InChI | InChI=1S/C11H20N2O4/c1-10(2,3)17-9(14)13-6-4-11(15,5-7-13)8-12-16/h15H,4-8H2,1-3H3 |
| InChIKey | LASKEVVNGDTKDQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |