C15H27NO3 — CID 176766440
tert-butyl 4-hydroxy-4-pent-4-enylpiperidine-1-carboxylate (PubChem CID 176766440) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-pent-4-enylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-pent-4-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 176766440 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | tert-butyl 4-hydroxy-4-pent-4-enylpiperidine-1-carboxylate |
| SMILES | C=CCCCC1(O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H27NO3/c1-5-6-7-8-15(18)9-11-16(12-10-15)13(17)19-14(2,3)4/h5,18H,1,6-12H2,2-4H3 |
| InChIKey | UEOMUZBVLVGCQZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|