C22H42N3O4+ — CID 140674867
ditert-butyl 7-hex-5-enyl-1,4,7-triazonan-7-ium-1,4-dicarboxylate (PubChem CID 140674867) has the molecular formula C22H42N3O4+ and a molecular weight of 412.60 g/mol. Its IUPAC name is ditert-butyl 7-hex-5-enyl-1,4,7-triazonan-7-ium-1,4-dicarboxylate.
| Compound Name | ditert-butyl 7-hex-5-enyl-1,4,7-triazonan-7-ium-1,4-dicarboxylate |
|---|---|
| PubChem CID | 140674867 |
| Molecular Formula | C22H42N3O4+ |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | ditert-butyl 7-hex-5-enyl-1,4,7-triazonan-7-ium-1,4-dicarboxylate |
| SMILES | C=CCCCC[NH+]1CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H41N3O4/c1-8-9-10-11-12-23-13-15-24(19(26)28-21(2,3)4)17-18-25(16-14-23)20(27)29-22(5,6)7/h8H,1,9-18H2,2-7H3/p+1 |
| InChIKey | KTVNRXXIEPYNTP-UHFFFAOYSA-O |
| XLogP | 2.72 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|