C14H22F2N2O3 — CID 10804451
tert-butyl 4-(2,2-difluoropent-4-enoyl)piperazine-1-carboxylate (PubChem CID 10804451) has the molecular formula C14H22F2N2O3 and a molecular weight of 304.34 g/mol. Its IUPAC name is tert-butyl 4-(2,2-difluoropent-4-enoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,2-difluoropent-4-enoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 10804451 |
| Molecular Formula | C14H22F2N2O3 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | tert-butyl 4-(2,2-difluoropent-4-enoyl)piperazine-1-carboxylate |
| SMILES | C=CCC(F)(F)C(=O)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H22F2N2O3/c1-5-6-14(15,16)11(19)17-7-9-18(10-8-17)12(20)21-13(2,3)4/h5H,1,6-10H2,2-4H3 |
| InChIKey | BGCYRFOEFAPLCW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|