C17H28F3N3O4 — CID 142065625
tert-butyl 4-pent-4-enoylpiperazine-1-carboxylate;N-(2,2,2-trifluoroethyl)formamide (PubChem CID 142065625) has the molecular formula C17H28F3N3O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is tert-butyl 4-pent-4-enoylpiperazine-1-carboxylate;N-(2,2,2-trifluoroethyl)formamide.
| Compound Name | tert-butyl 4-pent-4-enoylpiperazine-1-carboxylate;N-(2,2,2-trifluoroethyl)formamide |
|---|---|
| PubChem CID | 142065625 |
| Molecular Formula | C17H28F3N3O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | tert-butyl 4-pent-4-enoylpiperazine-1-carboxylate;N-(2,2,2-trifluoroethyl)formamide |
| SMILES | C=CCCC(=O)N1CCN(C(=O)OC(C)(C)C)CC1.O=CNCC(F)(F)F |
| InChI | InChI=1S/C14H24N2O3.C3H4F3NO/c1-5-6-7-12(17)15-8-10-16(11-9-15)13(18)19-14(2,3)4;4-3(5,6)1-7-2-8/h5H,1,6-11H2,2-4H3;2H,1H2,(H,7,8) |
| InChIKey | KHSFWZBYMUCYPK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|