C18H30F3N3O5 — CID 142189505
4-O-tert-butyl 1-O-prop-2-enyl 2-(2,2,2-trifluoroethylcarbamoyl)piperazine-1,4-dicarboxylate;ethane (PubChem CID 142189505) has the molecular formula C18H30F3N3O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-prop-2-enyl 2-(2,2,2-trifluoroethylcarbamoyl)piperazine-1,4-dicarboxylate;ethane.
| Compound Name | 4-O-tert-butyl 1-O-prop-2-enyl 2-(2,2,2-trifluoroethylcarbamoyl)piperazine-1,4-dicarboxylate;ethane |
|---|---|
| PubChem CID | 142189505 |
| Molecular Formula | C18H30F3N3O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 4-O-tert-butyl 1-O-prop-2-enyl 2-(2,2,2-trifluoroethylcarbamoyl)piperazine-1,4-dicarboxylate;ethane |
| SMILES | C=CCOC(=O)N1CCN(C(=O)OC(C)(C)C)CC1C(=O)NCC(F)(F)F.CC |
| InChI | InChI=1S/C16H24F3N3O5.C2H6/c1-5-8-26-14(25)22-7-6-21(13(24)27-15(2,3)4)9-11(22)12(23)20-10-16(17,18)19;1-2/h5,11H,1,6-10H2,2-4H3,(H,20,23);1-2H3 |
| InChIKey | DVKMVYGJBLTEAX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|