C17H31N3O6 — CID 90099640
ditert-butyl (2R)-2-(methoxymethylcarbamoyl)piperazine-1,4-dicarboxylate (PubChem CID 90099640) has the molecular formula C17H31N3O6 and a molecular weight of 373.45 g/mol. Its IUPAC name is ditert-butyl (2R)-2-(methoxymethylcarbamoyl)piperazine-1,4-dicarboxylate.
| Compound Name | ditert-butyl (2R)-2-(methoxymethylcarbamoyl)piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 90099640 |
| Molecular Formula | C17H31N3O6 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | ditert-butyl (2R)-2-(methoxymethylcarbamoyl)piperazine-1,4-dicarboxylate |
| SMILES | COCNC(=O)[C@H]1CN(C(=O)OC(C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31N3O6/c1-16(2,3)25-14(22)19-8-9-20(15(23)26-17(4,5)6)12(10-19)13(21)18-11-24-7/h12H,8-11H2,1-7H3,(H,18,21)/t12-/m1/s1 |
| InChIKey | JEHITEJDPDOTEW-GFCCVEGCSA-N |
| XLogP | 1.56 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|