C16H29N3O4 — CID 10806125
tert-butyl (3R)-4-acetyl-3-(tert-butylcarbamoyl)piperazine-1-carboxylate (PubChem CID 10806125) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is tert-butyl (3R)-4-acetyl-3-(tert-butylcarbamoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-4-acetyl-3-(tert-butylcarbamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 10806125 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | tert-butyl (3R)-4-acetyl-3-(tert-butylcarbamoyl)piperazine-1-carboxylate |
| SMILES | CC(=O)N1CCN(C(=O)OC(C)(C)C)C[C@@H]1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H29N3O4/c1-11(20)19-9-8-18(14(22)23-16(5,6)7)10-12(19)13(21)17-15(2,3)4/h12H,8-10H2,1-7H3,(H,17,21)/t12-/m1/s1 |
| InChIKey | TWQPXXRQBNMLLT-GFCCVEGCSA-N |
| XLogP | 1.37 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |