C15H28N2O3 — CID 171557754
tert-butyl 4-acetyl-3-butylpiperazine-1-carboxylate (PubChem CID 171557754) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is tert-butyl 4-acetyl-3-butylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-acetyl-3-butylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 171557754 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | tert-butyl 4-acetyl-3-butylpiperazine-1-carboxylate |
| SMILES | CCCCC1CN(C(=O)OC(C)(C)C)CCN1C(C)=O |
| InChI | InChI=1S/C15H28N2O3/c1-6-7-8-13-11-16(9-10-17(13)12(2)18)14(19)20-15(3,4)5/h13H,6-11H2,1-5H3 |
| InChIKey | YBELHPINEZRDNG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |