C16H30N2O5 — CID 69212205
ditert-butyl (2S)-2-(2-hydroxyethyl)piperazine-1,4-dicarboxylate (PubChem CID 69212205) has the molecular formula C16H30N2O5 and a molecular weight of 330.43 g/mol. Its IUPAC name is ditert-butyl (2S)-2-(2-hydroxyethyl)piperazine-1,4-dicarboxylate.
| Compound Name | ditert-butyl (2S)-2-(2-hydroxyethyl)piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 69212205 |
| Molecular Formula | C16H30N2O5 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | ditert-butyl (2S)-2-(2-hydroxyethyl)piperazine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)[C@@H](CCO)C1 |
| InChI | InChI=1S/C16H30N2O5/c1-15(2,3)22-13(20)17-8-9-18(12(11-17)7-10-19)14(21)23-16(4,5)6/h12,19H,7-11H2,1-6H3/t12-/m0/s1 |
| InChIKey | VUZKEHBQEOADAS-LBPRGKRZSA-N |
| XLogP | 2.23 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |