C17H32N6O4 — CID 18665371
tert-butyl (3S)-4-[(2S)-3-azido-2-hydroxypropyl]-3-(tert-butylcarbamoyl)piperazine-1-carboxylate (PubChem CID 18665371) has the molecular formula C17H32N6O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is tert-butyl (3S)-4-[(2S)-3-azido-2-hydroxypropyl]-3-(tert-butylcarbamoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-[(2S)-3-azido-2-hydroxypropyl]-3-(tert-butylcarbamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 18665371 |
| Molecular Formula | C17H32N6O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | tert-butyl (3S)-4-[(2S)-3-azido-2-hydroxypropyl]-3-(tert-butylcarbamoyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)NC(=O)[C@@H]1CN(C(=O)OC(C)(C)C)CCN1C[C@H](O)CN=[N+]=[N-] |
| InChI | InChI=1S/C17H32N6O4/c1-16(2,3)20-14(25)13-11-23(15(26)27-17(4,5)6)8-7-22(13)10-12(24)9-19-21-18/h12-13,24H,7-11H2,1-6H3,(H,20,25)/t12-,13+/m1/s1 |
| InChIKey | VPVIUKAIMKLNLZ-OLZOCXBDSA-N |
| XLogP | 1.49 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|