C19H30N4O4 — CID 10384999
phenyl 4-[(2S)-3-amino-2-hydroxypropyl]-3-(tert-butylcarbamoyl)piperazine-1-carboxylate (PubChem CID 10384999) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is phenyl 4-[(2S)-3-amino-2-hydroxypropyl]-3-(tert-butylcarbamoyl)piperazine-1-carboxylate.
| Compound Name | phenyl 4-[(2S)-3-amino-2-hydroxypropyl]-3-(tert-butylcarbamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 10384999 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | phenyl 4-[(2S)-3-amino-2-hydroxypropyl]-3-(tert-butylcarbamoyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)NC(=O)C1CN(C(=O)Oc2ccccc2)CCN1C[C@@H](O)CN |
| InChI | InChI=1S/C19H30N4O4/c1-19(2,3)21-17(25)16-13-23(10-9-22(16)12-14(24)11-20)18(26)27-15-7-5-4-6-8-15/h4-8,14,16,24H,9-13,20H2,1-3H3,(H,21,25)/t14-,16?/m0/s1 |
| InChIKey | RKQPTPWZVZHPCD-LBAUFKAWSA-N |
| XLogP | 0.41 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |