C19H31N5O2 — CID 131719114
(2S)-1-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-tert-butylpyrrolidine-2-carboxamide;molecular nitrogen (PubChem CID 131719114) has the molecular formula C19H31N5O2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (2S)-1-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-tert-butylpyrrolidine-2-carboxamide;molecular nitrogen.
| Compound Name | (2S)-1-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-tert-butylpyrrolidine-2-carboxamide;molecular nitrogen |
|---|---|
| PubChem CID | 131719114 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | (2S)-1-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-tert-butylpyrrolidine-2-carboxamide;molecular nitrogen |
| SMILES | CC(C)(C)NC(=O)[C@@H]1CCCN1C[C@@H](O)[C@@H](N)Cc1ccccc1.N#N |
| InChI | InChI=1S/C19H31N3O2.N2/c1-19(2,3)21-18(24)16-10-7-11-22(16)13-17(23)15(20)12-14-8-5-4-6-9-14;1-2/h4-6,8-9,15-17,23H,7,10-13,20H2,1-3H3,(H,21,24);/t15-,16-,17+;/m0./s1 |
| InChIKey | GQVVMUZNYAPSJB-JDFMPCBTSA-N |
| XLogP | 1.33 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|