C19H28ClN3O3 — CID 67722455
(2S)-1-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]-N-tert-butyl-4-chloropyrrolidine-2-carboxamide (PubChem CID 67722455) has the molecular formula C19H28ClN3O3 and a molecular weight of 381.90 g/mol. Its IUPAC name is (2S)-1-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]-N-tert-butyl-4-chloropyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]-N-tert-butyl-4-chloropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67722455 |
| Molecular Formula | C19H28ClN3O3 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (2S)-1-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]-N-tert-butyl-4-chloropyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1CC(Cl)CN1C(=O)[C@@H](O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C19H28ClN3O3/c1-19(2,3)22-17(25)15-10-13(20)11-23(15)18(26)16(24)14(21)9-12-7-5-4-6-8-12/h4-8,13-16,24H,9-11,21H2,1-3H3,(H,22,25)/t13?,14-,15-,16-/m0/s1 |
| InChIKey | NBUNCIFBILFSKE-JFKGFPBSSA-N |
| XLogP | 1.04 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|