C14H21NO3 — CID 7021090
tert-butyl (2S,3R)-3-amino-2-hydroxy-4-phenylbutanoate (PubChem CID 7021090) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-amino-2-hydroxy-4-phenylbutanoate.
| Compound Name | tert-butyl (2S,3R)-3-amino-2-hydroxy-4-phenylbutanoate |
|---|---|
| PubChem CID | 7021090 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | tert-butyl (2S,3R)-3-amino-2-hydroxy-4-phenylbutanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](O)[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C14H21NO3/c1-14(2,3)18-13(17)12(16)11(15)9-10-7-5-4-6-8-10/h4-8,11-12,16H,9,15H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | ITPFEPDHSLWUED-NEPJUHHUSA-N |
| XLogP | 1.26 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |