C16H25NO5 — CID 162225778
acetic acid;tert-butyl (2S,3S)-3-amino-2-hydroxy-4-phenylbutanoate (PubChem CID 162225778) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is acetic acid;tert-butyl (2S,3S)-3-amino-2-hydroxy-4-phenylbutanoate.
| Compound Name | acetic acid;tert-butyl (2S,3S)-3-amino-2-hydroxy-4-phenylbutanoate |
|---|---|
| PubChem CID | 162225778 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | acetic acid;tert-butyl (2S,3S)-3-amino-2-hydroxy-4-phenylbutanoate |
| SMILES | CC(=O)O.CC(C)(C)OC(=O)[C@@H](O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C14H21NO3.C2H4O2/c1-14(2,3)18-13(17)12(16)11(15)9-10-7-5-4-6-8-10;1-2(3)4/h4-8,11-12,16H,9,15H2,1-3H3;1H3,(H,3,4)/t11-,12-;/m0./s1 |
| InChIKey | ZUSXGUZYRDFIBZ-FXMYHANSSA-N |
| XLogP | 1.35 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |