C15H22ClNO3 — CID 21222318
tert-butyl 4-amino-2-benzyl-4-chloro-3-hydroxybutanoate (PubChem CID 21222318) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is tert-butyl 4-amino-2-benzyl-4-chloro-3-hydroxybutanoate.
| Compound Name | tert-butyl 4-amino-2-benzyl-4-chloro-3-hydroxybutanoate |
|---|---|
| PubChem CID | 21222318 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | tert-butyl 4-amino-2-benzyl-4-chloro-3-hydroxybutanoate |
| SMILES | CC(C)(C)OC(=O)C(Cc1ccccc1)C(O)C(N)Cl |
| InChI | InChI=1S/C15H22ClNO3/c1-15(2,3)20-14(19)11(12(18)13(16)17)9-10-7-5-4-6-8-10/h4-8,11-13,18H,9,17H2,1-3H3 |
| InChIKey | FDEMKPDAGFRQTO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|