C22H27NO4 — CID 70084320
4-O-tert-butyl 1-O-methyl 2-amino-3-[(4-phenylphenyl)methyl]butanedioate (PubChem CID 70084320) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl 2-amino-3-[(4-phenylphenyl)methyl]butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-methyl 2-amino-3-[(4-phenylphenyl)methyl]butanedioate |
|---|---|
| PubChem CID | 70084320 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl 2-amino-3-[(4-phenylphenyl)methyl]butanedioate |
| SMILES | COC(=O)C(N)C(Cc1ccc(-c2ccccc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27NO4/c1-22(2,3)27-20(24)18(19(23)21(25)26-4)14-15-10-12-17(13-11-15)16-8-6-5-7-9-16/h5-13,18-19H,14,23H2,1-4H3 |
| InChIKey | RRURFKGDBJADEP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |