C26H32O5 — CID 175104747
4-O-tert-butyl 1-O-methyl (2R)-3-[2-(4-phenylphenyl)acetyl]-2-propan-2-ylbutanedioate (PubChem CID 175104747) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl (2R)-3-[2-(4-phenylphenyl)acetyl]-2-propan-2-ylbutanedioate.
| Compound Name | 4-O-tert-butyl 1-O-methyl (2R)-3-[2-(4-phenylphenyl)acetyl]-2-propan-2-ylbutanedioate |
|---|---|
| PubChem CID | 175104747 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl (2R)-3-[2-(4-phenylphenyl)acetyl]-2-propan-2-ylbutanedioate |
| SMILES | COC(=O)[C@H](C(C)C)C(C(=O)Cc1ccc(-c2ccccc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H32O5/c1-17(2)22(24(28)30-6)23(25(29)31-26(3,4)5)21(27)16-18-12-14-20(15-13-18)19-10-8-7-9-11-19/h7-15,17,22-23H,16H2,1-6H3/t22-,23?/m1/s1 |
| InChIKey | ZUEIWOXVISMTPG-WTQRLHSKSA-N |
| XLogP | 4.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|