C22H26O3 — CID 58675133
tert-butyl 2-methyl-3-oxo-5-(4-phenylphenyl)pentanoate (PubChem CID 58675133) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is tert-butyl 2-methyl-3-oxo-5-(4-phenylphenyl)pentanoate.
| Compound Name | tert-butyl 2-methyl-3-oxo-5-(4-phenylphenyl)pentanoate |
|---|---|
| PubChem CID | 58675133 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | tert-butyl 2-methyl-3-oxo-5-(4-phenylphenyl)pentanoate |
| SMILES | CC(C(=O)CCc1ccc(-c2ccccc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H26O3/c1-16(21(24)25-22(2,3)4)20(23)15-12-17-10-13-19(14-11-17)18-8-6-5-7-9-18/h5-11,13-14,16H,12,15H2,1-4H3 |
| InChIKey | BBUFLILPUIMHOX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|