C28H36O5 — CID 148687228
ditert-butyl (3R)-4-oxo-3-[(4-phenylphenyl)methyl]heptanedioate (PubChem CID 148687228) has the molecular formula C28H36O5 and a molecular weight of 452.59 g/mol. Its IUPAC name is ditert-butyl (3R)-4-oxo-3-[(4-phenylphenyl)methyl]heptanedioate.
| Compound Name | ditert-butyl (3R)-4-oxo-3-[(4-phenylphenyl)methyl]heptanedioate |
|---|---|
| PubChem CID | 148687228 |
| Molecular Formula | C28H36O5 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | ditert-butyl (3R)-4-oxo-3-[(4-phenylphenyl)methyl]heptanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(=O)C(CC(=O)OC(C)(C)C)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H36O5/c1-27(2,3)32-25(30)17-16-24(29)23(19-26(31)33-28(4,5)6)18-20-12-14-22(15-13-20)21-10-8-7-9-11-21/h7-15,23H,16-19H2,1-6H3 |
| InChIKey | NSTAWPXSFHHBRL-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |