C25H31NO5 — CID 59607550
4-[[(2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-[(4-phenylphenyl)methyl]butanoyl]amino]butanoic acid (PubChem CID 59607550) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-[[(2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-[(4-phenylphenyl)methyl]butanoyl]amino]butanoic acid.
| Compound Name | 4-[[(2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-[(4-phenylphenyl)methyl]butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 59607550 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 4-[[(2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-[(4-phenylphenyl)methyl]butanoyl]amino]butanoic acid |
| SMILES | CC(C)(C)OC(=O)CC(Cc1ccc(-c2ccccc2)cc1)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C25H31NO5/c1-25(2,3)31-23(29)17-21(24(30)26-15-7-10-22(27)28)16-18-11-13-20(14-12-18)19-8-5-4-6-9-19/h4-6,8-9,11-14,21H,7,10,15-17H2,1-3H3,(H,26,30)(H,27,28) |
| InChIKey | LKNSHSXTGQMOQV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|