C28H32NO5P — CID 129195923
4-[[2-[[hydroxy(2-phenylethyl)phosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]butanoic acid (PubChem CID 129195923) has the molecular formula C28H32NO5P and a molecular weight of 493.54 g/mol. Its IUPAC name is 4-[[2-[[hydroxy(2-phenylethyl)phosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]butanoic acid.
| Compound Name | 4-[[2-[[hydroxy(2-phenylethyl)phosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 129195923 |
| Molecular Formula | C28H32NO5P |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 4-[[2-[[hydroxy(2-phenylethyl)phosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)C(Cc1ccc(-c2ccccc2)cc1)CP(=O)(O)CCc1ccccc1 |
| InChI | InChI=1S/C28H32NO5P/c30-27(31)12-7-18-29-28(32)26(21-35(33,34)19-17-22-8-3-1-4-9-22)20-23-13-15-25(16-14-23)24-10-5-2-6-11-24/h1-6,8-11,13-16,26H,7,12,17-21H2,(H,29,32)(H,30,31)(H,33,34) |
| InChIKey | RPZPTIBYRVZLIA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|