C30H36NO5P — CID 135369937
(2S)-2-[[(2S)-2-[[hydroxy(2-phenylethyl)phosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]hexanoic acid (PubChem CID 135369937) has the molecular formula C30H36NO5P and a molecular weight of 521.59 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[hydroxy(2-phenylethyl)phosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[hydroxy(2-phenylethyl)phosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 135369937 |
| Molecular Formula | C30H36NO5P |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[hydroxy(2-phenylethyl)phosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)[C@H](Cc1ccc(-c2ccccc2)cc1)CP(=O)(O)CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C30H36NO5P/c1-2-3-14-28(30(33)34)31-29(32)27(22-37(35,36)20-19-23-10-6-4-7-11-23)21-24-15-17-26(18-16-24)25-12-8-5-9-13-25/h4-13,15-18,27-28H,2-3,14,19-22H2,1H3,(H,31,32)(H,33,34)(H,35,36)/t27-,28+/m1/s1 |
| InChIKey | ATNAYRNVTATRBU-IZLXSDGUSA-N |
| XLogP | 5.78 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|