C21H31NO4 — CID 18659792
(2S)-2-[[(2R)-2-benzyl-5,5-dimethyl-4-oxohexanoyl]amino]hexanoic acid (PubChem CID 18659792) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-benzyl-5,5-dimethyl-4-oxohexanoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-benzyl-5,5-dimethyl-4-oxohexanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18659792 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | (2S)-2-[[(2R)-2-benzyl-5,5-dimethyl-4-oxohexanoyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)[C@@H](CC(=O)C(C)(C)C)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H31NO4/c1-5-6-12-17(20(25)26)22-19(24)16(14-18(23)21(2,3)4)13-15-10-8-7-9-11-15/h7-11,16-17H,5-6,12-14H2,1-4H3,(H,22,24)(H,25,26)/t16-,17+/m1/s1 |
| InChIKey | JNKDGGADFCGKDJ-SJORKVTESA-N |
| XLogP | 3.61 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |