C18H28N2O4 — CID 90655730
2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]octanoic acid (PubChem CID 90655730) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]octanoic acid.
| Compound Name | 2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]octanoic acid |
|---|---|
| PubChem CID | 90655730 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]octanoic acid |
| SMILES | CCCCCCC(NC(=O)[C@@H](O)[C@H](N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H28N2O4/c1-2-3-4-8-11-15(18(23)24)20-17(22)16(21)14(19)12-13-9-6-5-7-10-13/h5-7,9-10,14-16,21H,2-4,8,11-12,19H2,1H3,(H,20,22)(H,23,24)/t14-,15?,16+/m1/s1 |
| InChIKey | QAHVMHDNURLFLM-TUOGLVOQSA-N |
| XLogP | 1.46 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|