C25H39NO4 — CID 54366520
(2S)-2-[(2-hexyl-3-oxodecanoyl)amino]-3-phenylpropanoic acid (PubChem CID 54366520) has the molecular formula C25H39NO4 and a molecular weight of 417.59 g/mol. Its IUPAC name is (2S)-2-[(2-hexyl-3-oxodecanoyl)amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(2-hexyl-3-oxodecanoyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 54366520 |
| Molecular Formula | C25H39NO4 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | (2S)-2-[(2-hexyl-3-oxodecanoyl)amino]-3-phenylpropanoic acid |
| SMILES | CCCCCCCC(=O)C(CCCCCC)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H39NO4/c1-3-5-7-9-14-18-23(27)21(17-13-8-6-4-2)24(28)26-22(25(29)30)19-20-15-11-10-12-16-20/h10-12,15-16,21-22H,3-9,13-14,17-19H2,1-2H3,(H,26,28)(H,29,30)/t21?,22-/m0/s1 |
| InChIKey | UQECHAYCZOVARW-KEKNWZKVSA-N |
| XLogP | 5.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|