C29H42N2O6 — CID 21309939
(2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-hexyl-3-oxodecanoyl)amino]-3-phenylpropanoate (PubChem CID 21309939) has the molecular formula C29H42N2O6 and a molecular weight of 514.66 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-hexyl-3-oxodecanoyl)amino]-3-phenylpropanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-hexyl-3-oxodecanoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 21309939 |
| Molecular Formula | C29H42N2O6 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-hexyl-3-oxodecanoyl)amino]-3-phenylpropanoate |
| SMILES | CCCCCCCC(=O)C(CCCCCC)C(=O)N[C@@H](Cc1ccccc1)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C29H42N2O6/c1-3-5-7-9-14-18-25(32)23(17-13-8-6-4-2)28(35)30-24(21-22-15-11-10-12-16-22)29(36)37-31-26(33)19-20-27(31)34/h10-12,15-16,23-24H,3-9,13-14,17-21H2,1-2H3,(H,30,35)/t23?,24-/m0/s1 |
| InChIKey | SJWTWIMSFBDTBC-CGAIIQECSA-N |
| XLogP | 4.84 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|